C14H14N2OS2 — CID 43290042
4-[3-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]propoxy]benzonitrile (PubChem CID 43290042) has the molecular formula C14H14N2OS2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 4-[3-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]propoxy]benzonitrile.
| Compound Name | 4-[3-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]propoxy]benzonitrile |
|---|---|
| PubChem CID | 43290042 |
| Molecular Formula | C14H14N2OS2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 4-[3-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]propoxy]benzonitrile |
| SMILES | Cc1csc(SCCCOc2ccc(C#N)cc2)n1 |
| InChI | InChI=1S/C14H14N2OS2/c1-11-10-19-14(16-11)18-8-2-7-17-13-5-3-12(9-15)4-6-13/h3-6,10H,2,7-8H2,1H3 |
| InChIKey | OXPZIXYKTRJTAY-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|