C20H19N3OS — CID 112830284
2-[3-(4-cyanophenoxy)propylsulfanyl]-5,6,7,8-tetrahydroquinoline-3-carbonitrile (PubChem CID 112830284) has the molecular formula C20H19N3OS and a molecular weight of 349.46 g/mol. Its IUPAC name is 2-[3-(4-cyanophenoxy)propylsulfanyl]-5,6,7,8-tetrahydroquinoline-3-carbonitrile.
| Compound Name | 2-[3-(4-cyanophenoxy)propylsulfanyl]-5,6,7,8-tetrahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 112830284 |
| Molecular Formula | C20H19N3OS |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 2-[3-(4-cyanophenoxy)propylsulfanyl]-5,6,7,8-tetrahydroquinoline-3-carbonitrile |
| SMILES | N#Cc1ccc(OCCCSc2nc3c(cc2C#N)CCCC3)cc1 |
| InChI | InChI=1S/C20H19N3OS/c21-13-15-6-8-18(9-7-15)24-10-3-11-25-20-17(14-22)12-16-4-1-2-5-19(16)23-20/h6-9,12H,1-5,10-11H2 |
| InChIKey | DTEGLWRETAXVNE-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 69.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|