C20H17N3O2S — CID 4592760
2-[3-(1,3-dioxoisoindol-2-yl)propylsulfanyl]-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbonitrile (PubChem CID 4592760) has the molecular formula C20H17N3O2S and a molecular weight of 363.44 g/mol. Its IUPAC name is 2-[3-(1,3-dioxoisoindol-2-yl)propylsulfanyl]-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbonitrile.
| Compound Name | 2-[3-(1,3-dioxoisoindol-2-yl)propylsulfanyl]-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 4592760 |
| Molecular Formula | C20H17N3O2S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | 2-[3-(1,3-dioxoisoindol-2-yl)propylsulfanyl]-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbonitrile |
| SMILES | N#Cc1cc2c(nc1SCCCN1C(=O)c3ccccc3C1=O)CCC2 |
| InChI | InChI=1S/C20H17N3O2S/c21-12-14-11-13-5-3-8-17(13)22-18(14)26-10-4-9-23-19(24)15-6-1-2-7-16(15)20(23)25/h1-2,6-7,11H,3-5,8-10H2 |
| InChIKey | FDIBRLCAZQTHEK-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 74.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|