C15H20N2S2 — CID 3313460
2-(butylsulfanylmethylsulfanyl)-5,6,7,8-tetrahydroquinoline-3-carbonitrile (PubChem CID 3313460) has the molecular formula C15H20N2S2 and a molecular weight of 292.47 g/mol. Its IUPAC name is 2-(butylsulfanylmethylsulfanyl)-5,6,7,8-tetrahydroquinoline-3-carbonitrile.
| Compound Name | 2-(butylsulfanylmethylsulfanyl)-5,6,7,8-tetrahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 3313460 |
| Molecular Formula | C15H20N2S2 |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 2-(butylsulfanylmethylsulfanyl)-5,6,7,8-tetrahydroquinoline-3-carbonitrile |
| SMILES | CCCCSCSc1nc2c(cc1C#N)CCCC2 |
| InChI | InChI=1S/C15H20N2S2/c1-2-3-8-18-11-19-15-13(10-16)9-12-6-4-5-7-14(12)17-15/h9H,2-8,11H2,1H3 |
| InChIKey | CDFUHOHUJMXBCS-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|