C19H28N2OS2 — CID 3313463
2-(octylsulfinylmethylsulfanyl)-5,6,7,8-tetrahydroquinoline-3-carbonitrile (PubChem CID 3313463) has the molecular formula C19H28N2OS2 and a molecular weight of 364.58 g/mol. Its IUPAC name is 2-(octylsulfinylmethylsulfanyl)-5,6,7,8-tetrahydroquinoline-3-carbonitrile.
| Compound Name | 2-(octylsulfinylmethylsulfanyl)-5,6,7,8-tetrahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 3313463 |
| Molecular Formula | C19H28N2OS2 |
| Molecular Weight | 364.58 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 2-(octylsulfinylmethylsulfanyl)-5,6,7,8-tetrahydroquinoline-3-carbonitrile |
| SMILES | CCCCCCCCS(=O)CSc1nc2c(cc1C#N)CCCC2 |
| InChI | InChI=1S/C19H28N2OS2/c1-2-3-4-5-6-9-12-24(22)15-23-19-17(14-20)13-16-10-7-8-11-18(16)21-19/h13H,2-12,15H2,1H3 |
| InChIKey | CNVGGYPJLBPJBB-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 53.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.58 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|