C6H10N2OS2 — CID 131223188
O-[2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]ethyl]hydroxylamine (PubChem CID 131223188) has the molecular formula C6H10N2OS2 and a molecular weight of 190.29 g/mol. Its IUPAC name is O-[2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]ethyl]hydroxylamine.
| Compound Name | O-[2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]ethyl]hydroxylamine |
|---|---|
| PubChem CID | 131223188 |
| Molecular Formula | C6H10N2OS2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.02 |
| IUPAC Name | O-[2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]ethyl]hydroxylamine |
| SMILES | Cc1csc(SCCON)n1 |
| InChI | InChI=1S/C6H10N2OS2/c1-5-4-11-6(8-5)10-3-2-9-7/h4H,2-3,7H2,1H3 |
| InChIKey | DBNDDWQZIOXDNE-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|