C13H12N2OS2 — CID 43290043
2-[2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]ethoxy]benzonitrile (PubChem CID 43290043) has the molecular formula C13H12N2OS2 and a molecular weight of 276.39 g/mol. Its IUPAC name is 2-[2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]ethoxy]benzonitrile.
| Compound Name | 2-[2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]ethoxy]benzonitrile |
|---|---|
| PubChem CID | 43290043 |
| Molecular Formula | C13H12N2OS2 |
| Molecular Weight | 276.39 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | 2-[2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]ethoxy]benzonitrile |
| SMILES | Cc1csc(SCCOc2ccccc2C#N)n1 |
| InChI | InChI=1S/C13H12N2OS2/c1-10-9-18-13(15-10)17-7-6-16-12-5-3-2-4-11(12)8-14/h2-5,9H,6-7H2,1H3 |
| InChIKey | SKRYREJWBGARHS-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.39 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|