C14H14N2O2S — CID 106922528
2-[3-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]propoxy]benzonitrile (PubChem CID 106922528) has the molecular formula C14H14N2O2S and a molecular weight of 274.35 g/mol. Its IUPAC name is 2-[3-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]propoxy]benzonitrile.
| Compound Name | 2-[3-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]propoxy]benzonitrile |
|---|---|
| PubChem CID | 106922528 |
| Molecular Formula | C14H14N2O2S |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 2-[3-[(4-methyl-1,3-oxazol-2-yl)sulfanyl]propoxy]benzonitrile |
| SMILES | Cc1coc(SCCCOc2ccccc2C#N)n1 |
| InChI | InChI=1S/C14H14N2O2S/c1-11-10-18-14(16-11)19-8-4-7-17-13-6-3-2-5-12(13)9-15/h2-3,5-6,10H,4,7-8H2,1H3 |
| InChIKey | GHRUSOMRYFSRTD-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 59.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|