C16H13F2NOS — CID 43290144
2-[3-(2,4-difluorophenyl)sulfanylpropoxy]benzonitrile (PubChem CID 43290144) has the molecular formula C16H13F2NOS and a molecular weight of 305.35 g/mol. Its IUPAC name is 2-[3-(2,4-difluorophenyl)sulfanylpropoxy]benzonitrile.
| Compound Name | 2-[3-(2,4-difluorophenyl)sulfanylpropoxy]benzonitrile |
|---|---|
| PubChem CID | 43290144 |
| Molecular Formula | C16H13F2NOS |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 2-[3-(2,4-difluorophenyl)sulfanylpropoxy]benzonitrile |
| SMILES | N#Cc1ccccc1OCCCSc1ccc(F)cc1F |
| InChI | InChI=1S/C16H13F2NOS/c17-13-6-7-16(14(18)10-13)21-9-3-8-20-15-5-2-1-4-12(15)11-19/h1-2,4-7,10H,3,8-9H2 |
| InChIKey | XOYSPYLPIJRKCI-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|