C16H13F2NO2 — CID 62785228
2-[3-(3,5-difluorophenoxy)propoxy]benzonitrile (PubChem CID 62785228) has the molecular formula C16H13F2NO2 and a molecular weight of 289.28 g/mol. Its IUPAC name is 2-[3-(3,5-difluorophenoxy)propoxy]benzonitrile.
| Compound Name | 2-[3-(3,5-difluorophenoxy)propoxy]benzonitrile |
|---|---|
| PubChem CID | 62785228 |
| Molecular Formula | C16H13F2NO2 |
| Molecular Weight | 289.28 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 2-[3-(3,5-difluorophenoxy)propoxy]benzonitrile |
| SMILES | N#Cc1ccccc1OCCCOc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C16H13F2NO2/c17-13-8-14(18)10-15(9-13)20-6-3-7-21-16-5-2-1-4-12(16)11-19/h1-2,4-5,8-10H,3,6-7H2 |
| InChIKey | IJPFXSWKVSYOQH-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.28 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|