C11H8N2S2 — CID 28602391
2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]benzonitrile (PubChem CID 28602391) has the molecular formula C11H8N2S2 and a molecular weight of 232.33 g/mol. Its IUPAC name is 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]benzonitrile.
| Compound Name | 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]benzonitrile |
|---|---|
| PubChem CID | 28602391 |
| Molecular Formula | C11H8N2S2 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.01 |
| IUPAC Name | 2-[(4-methyl-1,3-thiazol-2-yl)sulfanyl]benzonitrile |
| SMILES | Cc1csc(Sc2ccccc2C#N)n1 |
| InChI | InChI=1S/C11H8N2S2/c1-8-7-14-11(13-8)15-10-5-3-2-4-9(10)6-12/h2-5,7H,1H3 |
| InChIKey | FTGGJCNCWSXSBG-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |