C12H5ClN2S — CID 51039242
3-[2-(2-chloro-1,3-thiazol-4-yl)ethynyl]benzonitrile (PubChem CID 51039242) has the molecular formula C12H5ClN2S and a molecular weight of 244.71 g/mol. Its IUPAC name is 3-[2-(2-chloro-1,3-thiazol-4-yl)ethynyl]benzonitrile.
| Compound Name | 3-[2-(2-chloro-1,3-thiazol-4-yl)ethynyl]benzonitrile |
|---|---|
| PubChem CID | 51039242 |
| Molecular Formula | C12H5ClN2S |
| Molecular Weight | 244.71 g/mol |
| Exact Mass | 243.99 |
| IUPAC Name | 3-[2-(2-chloro-1,3-thiazol-4-yl)ethynyl]benzonitrile |
| SMILES | N#Cc1cccc(C#Cc2csc(Cl)n2)c1 |
| InChI | InChI=1S/C12H5ClN2S/c13-12-15-11(8-16-12)5-4-9-2-1-3-10(6-9)7-14/h1-3,6,8H |
| InChIKey | STYCIMFVGFCSIX-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.71 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|