About 3-[2-(3,4-dichlorophenyl)-1,3-thiazol-4-yl]benzonitrile
3-[2-(3,4-dichlorophenyl)-1,3-thiazol-4-yl]benzonitrile (PubChem CID 81495135) has the molecular formula C16H8Cl2N2S
and a molecular weight of 331.23 g/mol. Its IUPAC name is 3-[2-(3,4-dichlorophenyl)-1,3-thiazol-4-yl]benzonitrile.
Molecular Properties
| Compound Name | 3-[2-(3,4-dichlorophenyl)-1,3-thiazol-4-yl]benzonitrile |
| PubChem CID | 81495135 |
| Molecular Formula | C16H8Cl2N2S |
| Molecular Weight | 331.23 g/mol |
| Exact Mass | 329.98 |
| IUPAC Name | 3-[2-(3,4-dichlorophenyl)-1,3-thiazol-4-yl]benzonitrile |
| SMILES | N#Cc1cccc(-c2csc(-c3ccc(Cl)c(Cl)c3)n2)c1 |
| InChI | InChI=1S/C16H8Cl2N2S/c17-13-5-4-12(7-14(13)18)16-20-15(9-21-16)11-3-1-2-10(6-11)8-19/h1-7,9H |
| InChIKey | MMXNWAHOXBOXBA-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 331.23 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[2-(3,4-dichlorophenyl)-1,3-thiazol-4-yl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(3,4-dichlorophenyl)-1,3-thiazol-4-yl]benzonitrile?
The IUPAC name of 3-[2-(3,4-dichlorophenyl)-1,3-thiazol-4-yl]benzonitrile (CID 81495135) is 3-[2-(3,4-dichlorophenyl)-1,3-thiazol-4-yl]benzonitrile.
What is the SMILES notation for 3-[2-(3,4-dichlorophenyl)-1,3-thiazol-4-yl]benzonitrile?
The canonical SMILES for 3-[2-(3,4-dichlorophenyl)-1,3-thiazol-4-yl]benzonitrile is N#Cc1cccc(-c2csc(-c3ccc(Cl)c(Cl)c3)n2)c1.
What is the InChIKey of 3-[2-(3,4-dichlorophenyl)-1,3-thiazol-4-yl]benzonitrile?
The InChIKey is MMXNWAHOXBOXBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H8Cl2N2S/c17-13-5-4-12(7-14(13)18)16-20-15(9-21-16)11-3-1-2-10(6-11)8-19/h1-7,9H.
What are the key properties of 3-[2-(3,4-dichlorophenyl)-1,3-thiazol-4-yl]benzonitrile?
3-[2-(3,4-dichlorophenyl)-1,3-thiazol-4-yl]benzonitrile has a molecular weight of 331.23 g/mol, XLogP of 5.66, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(3,4-dichlorophenyl)-1,3-thiazol-4-yl]benzonitrile is sourced from PubChem (CID 81495135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).