C17H13N3S — CID 82733378
3-[2-(3-ethyl-2-pyridinyl)-1,3-thiazol-4-yl]benzonitrile (PubChem CID 82733378) has the molecular formula C17H13N3S and a molecular weight of 291.38 g/mol. Its IUPAC name is 3-[2-(3-ethyl-2-pyridinyl)-1,3-thiazol-4-yl]benzonitrile.
| Compound Name | 3-[2-(3-ethyl-2-pyridinyl)-1,3-thiazol-4-yl]benzonitrile |
|---|---|
| PubChem CID | 82733378 |
| Molecular Formula | C17H13N3S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 3-[2-(3-ethyl-2-pyridinyl)-1,3-thiazol-4-yl]benzonitrile |
| SMILES | CCc1cccnc1-c1nc(-c2cccc(C#N)c2)cs1 |
| InChI | InChI=1S/C17H13N3S/c1-2-13-7-4-8-19-16(13)17-20-15(11-21-17)14-6-3-5-12(9-14)10-18/h3-9,11H,2H2,1H3 |
| InChIKey | SCKQVIFNZBKOEZ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |