C11H6FNS — CID 52919581
2-(18F)fluoro-4-(2-phenylethynyl)-1,3-thiazole (PubChem CID 52919581) has the molecular formula C11H6FNS and a molecular weight of 202.24 g/mol. Its IUPAC name is 2-(18F)fluoro-4-(2-phenylethynyl)-1,3-thiazole.
| Compound Name | 2-(18F)fluoro-4-(2-phenylethynyl)-1,3-thiazole |
|---|---|
| PubChem CID | 52919581 |
| Molecular Formula | C11H6FNS |
| Molecular Weight | 202.24 g/mol |
| Exact Mass | 202.02 |
| IUPAC Name | 2-(18F)fluoro-4-(2-phenylethynyl)-1,3-thiazole |
| SMILES | [18F]c1nc(C#Cc2ccccc2)cs1 |
| InChI | InChI=1S/C11H6FNS/c12-11-13-10(8-14-11)7-6-9-4-2-1-3-5-9/h1-5,8H/i12-1 |
| InChIKey | RTSSDOUVTZLNLE-DWSYCVKZSA-N |
| XLogP | 2.68 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.24 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|