C12H12ClNOS2 — CID 47096462
2-[2-(3-chlorophenoxy)ethylsulfanyl]-4-methyl-1,3-thiazole (PubChem CID 47096462) has the molecular formula C12H12ClNOS2 and a molecular weight of 285.82 g/mol. Its IUPAC name is 2-[2-(3-chlorophenoxy)ethylsulfanyl]-4-methyl-1,3-thiazole.
| Compound Name | 2-[2-(3-chlorophenoxy)ethylsulfanyl]-4-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 47096462 |
| Molecular Formula | C12H12ClNOS2 |
| Molecular Weight | 285.82 g/mol |
| Exact Mass | 285.00 |
| IUPAC Name | 2-[2-(3-chlorophenoxy)ethylsulfanyl]-4-methyl-1,3-thiazole |
| SMILES | Cc1csc(SCCOc2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C12H12ClNOS2/c1-9-8-17-12(14-9)16-6-5-15-11-4-2-3-10(13)7-11/h2-4,7-8H,5-6H2,1H3 |
| InChIKey | GCBFJRSWDCBWOC-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.82 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|