C13H16ClN3OS — CID 47094897
3-[2-(3-chlorophenoxy)ethylsulfanyl]-4-propan-2-yl-1,2,4-triazole (PubChem CID 47094897) has the molecular formula C13H16ClN3OS and a molecular weight of 297.81 g/mol. Its IUPAC name is 3-[2-(3-chlorophenoxy)ethylsulfanyl]-4-propan-2-yl-1,2,4-triazole.
| Compound Name | 3-[2-(3-chlorophenoxy)ethylsulfanyl]-4-propan-2-yl-1,2,4-triazole |
|---|---|
| PubChem CID | 47094897 |
| Molecular Formula | C13H16ClN3OS |
| Molecular Weight | 297.81 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 3-[2-(3-chlorophenoxy)ethylsulfanyl]-4-propan-2-yl-1,2,4-triazole |
| SMILES | CC(C)n1cnnc1SCCOc1cccc(Cl)c1 |
| InChI | InChI=1S/C13H16ClN3OS/c1-10(2)17-9-15-16-13(17)19-7-6-18-12-5-3-4-11(14)8-12/h3-5,8-10H,6-7H2,1-2H3 |
| InChIKey | CSANULIEIABJAR-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.81 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|