C16H23N3O2S — CID 84602685
4-propan-2-yl-3-[2-(4-propoxyphenoxy)ethylsulfanyl]-1,2,4-triazole (PubChem CID 84602685) has the molecular formula C16H23N3O2S and a molecular weight of 321.45 g/mol. Its IUPAC name is 4-propan-2-yl-3-[2-(4-propoxyphenoxy)ethylsulfanyl]-1,2,4-triazole.
| Compound Name | 4-propan-2-yl-3-[2-(4-propoxyphenoxy)ethylsulfanyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 84602685 |
| Molecular Formula | C16H23N3O2S |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 4-propan-2-yl-3-[2-(4-propoxyphenoxy)ethylsulfanyl]-1,2,4-triazole |
| SMILES | CCCOc1ccc(OCCSc2nncn2C(C)C)cc1 |
| InChI | InChI=1S/C16H23N3O2S/c1-4-9-20-14-5-7-15(8-6-14)21-10-11-22-16-18-17-12-19(16)13(2)3/h5-8,12-13H,4,9-11H2,1-3H3 |
| InChIKey | CGWLSWKJSAZFNS-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|