C16H22N4O2S — CID 38668907
4-cyclopropyl-5-[2-(4-propoxyphenoxy)ethylsulfanyl]-1,2,4-triazol-3-amine (PubChem CID 38668907) has the molecular formula C16H22N4O2S and a molecular weight of 334.45 g/mol. Its IUPAC name is 4-cyclopropyl-5-[2-(4-propoxyphenoxy)ethylsulfanyl]-1,2,4-triazol-3-amine.
| Compound Name | 4-cyclopropyl-5-[2-(4-propoxyphenoxy)ethylsulfanyl]-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 38668907 |
| Molecular Formula | C16H22N4O2S |
| Molecular Weight | 334.45 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 4-cyclopropyl-5-[2-(4-propoxyphenoxy)ethylsulfanyl]-1,2,4-triazol-3-amine |
| SMILES | CCCOc1ccc(OCCSc2nnc(N)n2C2CC2)cc1 |
| InChI | InChI=1S/C16H22N4O2S/c1-2-9-21-13-5-7-14(8-6-13)22-10-11-23-16-19-18-15(17)20(16)12-3-4-12/h5-8,12H,2-4,9-11H2,1H3,(H2,17,18) |
| InChIKey | SJSUAUWOWNKQDH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.45 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|