C11H13FN4OS — CID 47158236
5-[2-(4-fluorophenoxy)ethylsulfanyl]-4-methyl-1,2,4-triazol-3-amine (PubChem CID 47158236) has the molecular formula C11H13FN4OS and a molecular weight of 268.32 g/mol. Its IUPAC name is 5-[2-(4-fluorophenoxy)ethylsulfanyl]-4-methyl-1,2,4-triazol-3-amine.
| Compound Name | 5-[2-(4-fluorophenoxy)ethylsulfanyl]-4-methyl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 47158236 |
| Molecular Formula | C11H13FN4OS |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 5-[2-(4-fluorophenoxy)ethylsulfanyl]-4-methyl-1,2,4-triazol-3-amine |
| SMILES | Cn1c(N)nnc1SCCOc1ccc(F)cc1 |
| InChI | InChI=1S/C11H13FN4OS/c1-16-10(13)14-15-11(16)18-7-6-17-9-4-2-8(12)3-5-9/h2-5H,6-7H2,1H3,(H2,13,14) |
| InChIKey | UPQARVPRVRBKNW-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|