C16H15FN4OS — CID 78763094
3-[2-(4-fluorophenoxy)ethylsulfanyl]-5-phenyl-1,2,4-triazol-4-amine (PubChem CID 78763094) has the molecular formula C16H15FN4OS and a molecular weight of 330.39 g/mol. Its IUPAC name is 3-[2-(4-fluorophenoxy)ethylsulfanyl]-5-phenyl-1,2,4-triazol-4-amine.
| Compound Name | 3-[2-(4-fluorophenoxy)ethylsulfanyl]-5-phenyl-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 78763094 |
| Molecular Formula | C16H15FN4OS |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 3-[2-(4-fluorophenoxy)ethylsulfanyl]-5-phenyl-1,2,4-triazol-4-amine |
| SMILES | Nn1c(SCCOc2ccc(F)cc2)nnc1-c1ccccc1 |
| InChI | InChI=1S/C16H15FN4OS/c17-13-6-8-14(9-7-13)22-10-11-23-16-20-19-15(21(16)18)12-4-2-1-3-5-12/h1-9H,10-11,18H2 |
| InChIKey | CESXKOWVBKMOBR-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|