C17H17FN4OS — CID 78763033
3-[3-(4-fluorophenoxy)propylsulfanyl]-5-phenyl-1,2,4-triazol-4-amine (PubChem CID 78763033) has the molecular formula C17H17FN4OS and a molecular weight of 344.42 g/mol. Its IUPAC name is 3-[3-(4-fluorophenoxy)propylsulfanyl]-5-phenyl-1,2,4-triazol-4-amine.
| Compound Name | 3-[3-(4-fluorophenoxy)propylsulfanyl]-5-phenyl-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 78763033 |
| Molecular Formula | C17H17FN4OS |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 3-[3-(4-fluorophenoxy)propylsulfanyl]-5-phenyl-1,2,4-triazol-4-amine |
| SMILES | Nn1c(SCCCOc2ccc(F)cc2)nnc1-c1ccccc1 |
| InChI | InChI=1S/C17H17FN4OS/c18-14-7-9-15(10-8-14)23-11-4-12-24-17-21-20-16(22(17)19)13-5-2-1-3-6-13/h1-3,5-10H,4,11-12,19H2 |
| InChIKey | UKPCMDOEFFFFHQ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|