C20H24N4O2S — CID 39064677
3-[3-(3,4-dimethylphenoxy)propylsulfanyl]-5-(4-methoxyphenyl)-1,2,4-triazol-4-amine (PubChem CID 39064677) has the molecular formula C20H24N4O2S and a molecular weight of 384.51 g/mol. Its IUPAC name is 3-[3-(3,4-dimethylphenoxy)propylsulfanyl]-5-(4-methoxyphenyl)-1,2,4-triazol-4-amine.
| Compound Name | 3-[3-(3,4-dimethylphenoxy)propylsulfanyl]-5-(4-methoxyphenyl)-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 39064677 |
| Molecular Formula | C20H24N4O2S |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 3-[3-(3,4-dimethylphenoxy)propylsulfanyl]-5-(4-methoxyphenyl)-1,2,4-triazol-4-amine |
| SMILES | COc1ccc(-c2nnc(SCCCOc3ccc(C)c(C)c3)n2N)cc1 |
| InChI | InChI=1S/C20H24N4O2S/c1-14-5-8-18(13-15(14)2)26-11-4-12-27-20-23-22-19(24(20)21)16-6-9-17(25-3)10-7-16/h5-10,13H,4,11-12,21H2,1-3H3 |
| InChIKey | MIWCVJOEUFORLU-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|