C19H20F2N4O2S — CID 24675050
3-[4-(difluoromethoxy)phenyl]-5-[3-(3-methylphenoxy)propylsulfanyl]-1,2,4-triazol-4-amine (PubChem CID 24675050) has the molecular formula C19H20F2N4O2S and a molecular weight of 406.46 g/mol. Its IUPAC name is 3-[4-(difluoromethoxy)phenyl]-5-[3-(3-methylphenoxy)propylsulfanyl]-1,2,4-triazol-4-amine.
| Compound Name | 3-[4-(difluoromethoxy)phenyl]-5-[3-(3-methylphenoxy)propylsulfanyl]-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 24675050 |
| Molecular Formula | C19H20F2N4O2S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 3-[4-(difluoromethoxy)phenyl]-5-[3-(3-methylphenoxy)propylsulfanyl]-1,2,4-triazol-4-amine |
| SMILES | Cc1cccc(OCCCSc2nnc(-c3ccc(OC(F)F)cc3)n2N)c1 |
| InChI | InChI=1S/C19H20F2N4O2S/c1-13-4-2-5-16(12-13)26-10-3-11-28-19-24-23-17(25(19)22)14-6-8-15(9-7-14)27-18(20)21/h2,4-9,12,18H,3,10-11,22H2,1H3 |
| InChIKey | CLLYTRLNJGVZIX-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|