C13H14F2N4OS — CID 18275369
3-[4-(difluoromethoxy)phenyl]-5-(2-methylprop-2-enylsulfanyl)-1,2,4-triazol-4-amine (PubChem CID 18275369) has the molecular formula C13H14F2N4OS and a molecular weight of 312.35 g/mol. Its IUPAC name is 3-[4-(difluoromethoxy)phenyl]-5-(2-methylprop-2-enylsulfanyl)-1,2,4-triazol-4-amine.
| Compound Name | 3-[4-(difluoromethoxy)phenyl]-5-(2-methylprop-2-enylsulfanyl)-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 18275369 |
| Molecular Formula | C13H14F2N4OS |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 3-[4-(difluoromethoxy)phenyl]-5-(2-methylprop-2-enylsulfanyl)-1,2,4-triazol-4-amine |
| SMILES | C=C(C)CSc1nnc(-c2ccc(OC(F)F)cc2)n1N |
| InChI | InChI=1S/C13H14F2N4OS/c1-8(2)7-21-13-18-17-11(19(13)16)9-3-5-10(6-4-9)20-12(14)15/h3-6,12H,1,7,16H2,2H3 |
| InChIKey | JAJBKYKEJLWRNO-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|