C18H15F2N5O2S — CID 30064736
4-[2-[[4-amino-5-[4-(difluoromethoxy)phenyl]-1,2,4-triazol-3-yl]sulfanyl]ethoxy]benzonitrile (PubChem CID 30064736) has the molecular formula C18H15F2N5O2S and a molecular weight of 403.41 g/mol. Its IUPAC name is 4-[2-[[4-amino-5-[4-(difluoromethoxy)phenyl]-1,2,4-triazol-3-yl]sulfanyl]ethoxy]benzonitrile.
| Compound Name | 4-[2-[[4-amino-5-[4-(difluoromethoxy)phenyl]-1,2,4-triazol-3-yl]sulfanyl]ethoxy]benzonitrile |
|---|---|
| PubChem CID | 30064736 |
| Molecular Formula | C18H15F2N5O2S |
| Molecular Weight | 403.41 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | 4-[2-[[4-amino-5-[4-(difluoromethoxy)phenyl]-1,2,4-triazol-3-yl]sulfanyl]ethoxy]benzonitrile |
| SMILES | N#Cc1ccc(OCCSc2nnc(-c3ccc(OC(F)F)cc3)n2N)cc1 |
| InChI | InChI=1S/C18H15F2N5O2S/c19-17(20)27-15-7-3-13(4-8-15)16-23-24-18(25(16)22)28-10-9-26-14-5-1-12(11-21)2-6-14/h1-8,17H,9-10,22H2 |
| InChIKey | GLQWGQGMPFOIHZ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 98.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.41 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|