C17H14BrN5OS — CID 40930824
4-[2-[[4-amino-5-(2-bromophenyl)-1,2,4-triazol-3-yl]sulfanyl]ethoxy]benzonitrile (PubChem CID 40930824) has the molecular formula C17H14BrN5OS and a molecular weight of 416.30 g/mol. Its IUPAC name is 4-[2-[[4-amino-5-(2-bromophenyl)-1,2,4-triazol-3-yl]sulfanyl]ethoxy]benzonitrile.
| Compound Name | 4-[2-[[4-amino-5-(2-bromophenyl)-1,2,4-triazol-3-yl]sulfanyl]ethoxy]benzonitrile |
|---|---|
| PubChem CID | 40930824 |
| Molecular Formula | C17H14BrN5OS |
| Molecular Weight | 416.30 g/mol |
| Exact Mass | 415.01 |
| IUPAC Name | 4-[2-[[4-amino-5-(2-bromophenyl)-1,2,4-triazol-3-yl]sulfanyl]ethoxy]benzonitrile |
| SMILES | N#Cc1ccc(OCCSc2nnc(-c3ccccc3Br)n2N)cc1 |
| InChI | InChI=1S/C17H14BrN5OS/c18-15-4-2-1-3-14(15)16-21-22-17(23(16)20)25-10-9-24-13-7-5-12(11-19)6-8-13/h1-8H,9-10,20H2 |
| InChIKey | JMMXOEXHCVDMED-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 89.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.30 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|