C24H22BrN3OS — CID 5157782
4-benzyl-3-(2-bromophenyl)-5-[2-(4-methylphenoxy)ethylsulfanyl]-1,2,4-triazole (PubChem CID 5157782) has the molecular formula C24H22BrN3OS and a molecular weight of 480.43 g/mol. Its IUPAC name is 4-benzyl-3-(2-bromophenyl)-5-[2-(4-methylphenoxy)ethylsulfanyl]-1,2,4-triazole.
| Compound Name | 4-benzyl-3-(2-bromophenyl)-5-[2-(4-methylphenoxy)ethylsulfanyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 5157782 |
| Molecular Formula | C24H22BrN3OS |
| Molecular Weight | 480.43 g/mol |
| Exact Mass | 479.07 |
| IUPAC Name | 4-benzyl-3-(2-bromophenyl)-5-[2-(4-methylphenoxy)ethylsulfanyl]-1,2,4-triazole |
| SMILES | Cc1ccc(OCCSc2nnc(-c3ccccc3Br)n2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C24H22BrN3OS/c1-18-11-13-20(14-12-18)29-15-16-30-24-27-26-23(21-9-5-6-10-22(21)25)28(24)17-19-7-3-2-4-8-19/h2-14H,15-17H2,1H3 |
| InChIKey | BIKAREIMCLVIRC-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.43 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|