C18H17ClFN3OS — CID 55309077
3-(2-chlorophenyl)-5-[3-(4-fluorophenoxy)propylsulfanyl]-4-methyl-1,2,4-triazole (PubChem CID 55309077) has the molecular formula C18H17ClFN3OS and a molecular weight of 377.87 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-5-[3-(4-fluorophenoxy)propylsulfanyl]-4-methyl-1,2,4-triazole.
| Compound Name | 3-(2-chlorophenyl)-5-[3-(4-fluorophenoxy)propylsulfanyl]-4-methyl-1,2,4-triazole |
|---|---|
| PubChem CID | 55309077 |
| Molecular Formula | C18H17ClFN3OS |
| Molecular Weight | 377.87 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | 3-(2-chlorophenyl)-5-[3-(4-fluorophenoxy)propylsulfanyl]-4-methyl-1,2,4-triazole |
| SMILES | Cn1c(SCCCOc2ccc(F)cc2)nnc1-c1ccccc1Cl |
| InChI | InChI=1S/C18H17ClFN3OS/c1-23-17(15-5-2-3-6-16(15)19)21-22-18(23)25-12-4-11-24-14-9-7-13(20)8-10-14/h2-3,5-10H,4,11-12H2,1H3 |
| InChIKey | YQHAHGFYGDQZIA-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.87 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|