C17H15F2N3S2 — CID 112785164
3-(2-fluorophenyl)-5-[2-(4-fluorophenyl)sulfanylethylsulfanyl]-4-methyl-1,2,4-triazole (PubChem CID 112785164) has the molecular formula C17H15F2N3S2 and a molecular weight of 363.46 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-5-[2-(4-fluorophenyl)sulfanylethylsulfanyl]-4-methyl-1,2,4-triazole.
| Compound Name | 3-(2-fluorophenyl)-5-[2-(4-fluorophenyl)sulfanylethylsulfanyl]-4-methyl-1,2,4-triazole |
|---|---|
| PubChem CID | 112785164 |
| Molecular Formula | C17H15F2N3S2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | 3-(2-fluorophenyl)-5-[2-(4-fluorophenyl)sulfanylethylsulfanyl]-4-methyl-1,2,4-triazole |
| SMILES | Cn1c(SCCSc2ccc(F)cc2)nnc1-c1ccccc1F |
| InChI | InChI=1S/C17H15F2N3S2/c1-22-16(14-4-2-3-5-15(14)19)20-21-17(22)24-11-10-23-13-8-6-12(18)7-9-13/h2-9H,10-11H2,1H3 |
| InChIKey | WZZXDWQCTYLBOO-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|