C13H16FN3OS — CID 110931362
4-[[5-(2-fluorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]butan-1-ol (PubChem CID 110931362) has the molecular formula C13H16FN3OS and a molecular weight of 281.36 g/mol. Its IUPAC name is 4-[[5-(2-fluorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]butan-1-ol.
| Compound Name | 4-[[5-(2-fluorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]butan-1-ol |
|---|---|
| PubChem CID | 110931362 |
| Molecular Formula | C13H16FN3OS |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 4-[[5-(2-fluorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]butan-1-ol |
| SMILES | Cn1c(SCCCCO)nnc1-c1ccccc1F |
| InChI | InChI=1S/C13H16FN3OS/c1-17-12(10-6-2-3-7-11(10)14)15-16-13(17)19-9-5-4-8-18/h2-3,6-7,18H,4-5,8-9H2,1H3 |
| InChIKey | CHMHPZRYYALGQP-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|