C13H18FN3SSi — CID 56529378
[5-(2-fluorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanylmethyl-trimethylsilane (PubChem CID 56529378) has the molecular formula C13H18FN3SSi and a molecular weight of 295.46 g/mol. Its IUPAC name is [5-(2-fluorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanylmethyl-trimethylsilane.
| Compound Name | [5-(2-fluorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanylmethyl-trimethylsilane |
|---|---|
| PubChem CID | 56529378 |
| Molecular Formula | C13H18FN3SSi |
| Molecular Weight | 295.46 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | [5-(2-fluorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanylmethyl-trimethylsilane |
| SMILES | Cn1c(SC[Si](C)(C)C)nnc1-c1ccccc1F |
| InChI | InChI=1S/C13H18FN3SSi/c1-17-12(10-7-5-6-8-11(10)14)15-16-13(17)18-9-19(2,3)4/h5-8H,9H2,1-4H3 |
| InChIKey | DBKQWRBSPKBFRR-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.46 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|