C21H22ClN7S — CID 56528032
2-[5-[[5-(2-chlorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]pentyl]-5-phenyltetrazole (PubChem CID 56528032) has the molecular formula C21H22ClN7S and a molecular weight of 439.98 g/mol. Its IUPAC name is 2-[5-[[5-(2-chlorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]pentyl]-5-phenyltetrazole.
| Compound Name | 2-[5-[[5-(2-chlorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]pentyl]-5-phenyltetrazole |
|---|---|
| PubChem CID | 56528032 |
| Molecular Formula | C21H22ClN7S |
| Molecular Weight | 439.98 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | 2-[5-[[5-(2-chlorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]pentyl]-5-phenyltetrazole |
| SMILES | Cn1c(SCCCCCn2nnc(-c3ccccc3)n2)nnc1-c1ccccc1Cl |
| InChI | InChI=1S/C21H22ClN7S/c1-28-20(17-12-6-7-13-18(17)22)24-25-21(28)30-15-9-3-8-14-29-26-19(23-27-29)16-10-4-2-5-11-16/h2,4-7,10-13H,3,8-9,14-15H2,1H3 |
| InChIKey | USBVBHBWDARCIV-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 74.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.98 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|