C15H21FN4OS — CID 78762464
3-tert-butyl-5-[3-(4-fluorophenoxy)propylsulfanyl]-1,2,4-triazol-4-amine (PubChem CID 78762464) has the molecular formula C15H21FN4OS and a molecular weight of 324.43 g/mol. Its IUPAC name is 3-tert-butyl-5-[3-(4-fluorophenoxy)propylsulfanyl]-1,2,4-triazol-4-amine.
| Compound Name | 3-tert-butyl-5-[3-(4-fluorophenoxy)propylsulfanyl]-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 78762464 |
| Molecular Formula | C15H21FN4OS |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 3-tert-butyl-5-[3-(4-fluorophenoxy)propylsulfanyl]-1,2,4-triazol-4-amine |
| SMILES | CC(C)(C)c1nnc(SCCCOc2ccc(F)cc2)n1N |
| InChI | InChI=1S/C15H21FN4OS/c1-15(2,3)13-18-19-14(20(13)17)22-10-4-9-21-12-7-5-11(16)6-8-12/h5-8H,4,9-10,17H2,1-3H3 |
| InChIKey | RDFNFJUVYZGARR-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|