C11H10F4N4OS — CID 2457808
3-[2-(4-fluorophenoxy)ethylsulfanyl]-5-(trifluoromethyl)-1,2,4-triazol-4-amine (PubChem CID 2457808) has the molecular formula C11H10F4N4OS and a molecular weight of 322.29 g/mol. Its IUPAC name is 3-[2-(4-fluorophenoxy)ethylsulfanyl]-5-(trifluoromethyl)-1,2,4-triazol-4-amine.
| Compound Name | 3-[2-(4-fluorophenoxy)ethylsulfanyl]-5-(trifluoromethyl)-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 2457808 |
| Molecular Formula | C11H10F4N4OS |
| Molecular Weight | 322.29 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | 3-[2-(4-fluorophenoxy)ethylsulfanyl]-5-(trifluoromethyl)-1,2,4-triazol-4-amine |
| SMILES | Nn1c(SCCOc2ccc(F)cc2)nnc1C(F)(F)F |
| InChI | InChI=1S/C11H10F4N4OS/c12-7-1-3-8(4-2-7)20-5-6-21-10-18-17-9(19(10)16)11(13,14)15/h1-4H,5-6,16H2 |
| InChIKey | RDRHSWSEUULCFI-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.29 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|