C16H13Cl2FN4OS — CID 7915668
3-(2,5-dichlorophenyl)-5-[2-(4-fluorophenoxy)ethylsulfanyl]-1,2,4-triazol-4-amine (PubChem CID 7915668) has the molecular formula C16H13Cl2FN4OS and a molecular weight of 399.28 g/mol. Its IUPAC name is 3-(2,5-dichlorophenyl)-5-[2-(4-fluorophenoxy)ethylsulfanyl]-1,2,4-triazol-4-amine.
| Compound Name | 3-(2,5-dichlorophenyl)-5-[2-(4-fluorophenoxy)ethylsulfanyl]-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 7915668 |
| Molecular Formula | C16H13Cl2FN4OS |
| Molecular Weight | 399.28 g/mol |
| Exact Mass | 398.02 |
| IUPAC Name | 3-(2,5-dichlorophenyl)-5-[2-(4-fluorophenoxy)ethylsulfanyl]-1,2,4-triazol-4-amine |
| SMILES | Nn1c(SCCOc2ccc(F)cc2)nnc1-c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C16H13Cl2FN4OS/c17-10-1-6-14(18)13(9-10)15-21-22-16(23(15)20)25-8-7-24-12-4-2-11(19)3-5-12/h1-6,9H,7-8,20H2 |
| InChIKey | QOZPIJCYVJCNHR-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.28 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|