C17H16ClFN4O2S — CID 24671105
3-[2-(4-chlorophenoxy)ethylsulfanyl]-5-[(4-fluorophenoxy)methyl]-1,2,4-triazol-4-amine (PubChem CID 24671105) has the molecular formula C17H16ClFN4O2S and a molecular weight of 394.86 g/mol. Its IUPAC name is 3-[2-(4-chlorophenoxy)ethylsulfanyl]-5-[(4-fluorophenoxy)methyl]-1,2,4-triazol-4-amine.
| Compound Name | 3-[2-(4-chlorophenoxy)ethylsulfanyl]-5-[(4-fluorophenoxy)methyl]-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 24671105 |
| Molecular Formula | C17H16ClFN4O2S |
| Molecular Weight | 394.86 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | 3-[2-(4-chlorophenoxy)ethylsulfanyl]-5-[(4-fluorophenoxy)methyl]-1,2,4-triazol-4-amine |
| SMILES | Nn1c(COc2ccc(F)cc2)nnc1SCCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H16ClFN4O2S/c18-12-1-5-14(6-2-12)24-9-10-26-17-22-21-16(23(17)20)11-25-15-7-3-13(19)4-8-15/h1-8H,9-11,20H2 |
| InChIKey | VJYYSVJNJGALLL-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.86 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|