C12H10F3N5OS — CID 60516481
3-[2-[[4-amino-5-(trifluoromethyl)-1,2,4-triazol-3-yl]sulfanyl]ethoxy]benzonitrile (PubChem CID 60516481) has the molecular formula C12H10F3N5OS and a molecular weight of 329.31 g/mol. Its IUPAC name is 3-[2-[[4-amino-5-(trifluoromethyl)-1,2,4-triazol-3-yl]sulfanyl]ethoxy]benzonitrile.
| Compound Name | 3-[2-[[4-amino-5-(trifluoromethyl)-1,2,4-triazol-3-yl]sulfanyl]ethoxy]benzonitrile |
|---|---|
| PubChem CID | 60516481 |
| Molecular Formula | C12H10F3N5OS |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 3-[2-[[4-amino-5-(trifluoromethyl)-1,2,4-triazol-3-yl]sulfanyl]ethoxy]benzonitrile |
| SMILES | N#Cc1cccc(OCCSc2nnc(C(F)(F)F)n2N)c1 |
| InChI | InChI=1S/C12H10F3N5OS/c13-12(14,15)10-18-19-11(20(10)17)22-5-4-21-9-3-1-2-8(6-9)7-16/h1-3,6H,4-5,17H2 |
| InChIKey | GYHWKPWJIFBPPG-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 89.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|