C18H17N5OS — CID 60515030
3-[2-[1-(2,3-dimethylphenyl)tetrazol-5-yl]sulfanylethoxy]benzonitrile (PubChem CID 60515030) has the molecular formula C18H17N5OS and a molecular weight of 351.44 g/mol. Its IUPAC name is 3-[2-[1-(2,3-dimethylphenyl)tetrazol-5-yl]sulfanylethoxy]benzonitrile.
| Compound Name | 3-[2-[1-(2,3-dimethylphenyl)tetrazol-5-yl]sulfanylethoxy]benzonitrile |
|---|---|
| PubChem CID | 60515030 |
| Molecular Formula | C18H17N5OS |
| Molecular Weight | 351.44 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 3-[2-[1-(2,3-dimethylphenyl)tetrazol-5-yl]sulfanylethoxy]benzonitrile |
| SMILES | Cc1cccc(-n2nnnc2SCCOc2cccc(C#N)c2)c1C |
| InChI | InChI=1S/C18H17N5OS/c1-13-5-3-8-17(14(13)2)23-18(20-21-22-23)25-10-9-24-16-7-4-6-15(11-16)12-19/h3-8,11H,9-10H2,1-2H3 |
| InChIKey | ZNYFZYJIEQHLKJ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 76.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.44 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|