C19H22N4OS — CID 112771287
1-(2,6-dimethylphenyl)-5-[2-(3-ethylphenoxy)ethylsulfanyl]tetrazole (PubChem CID 112771287) has the molecular formula C19H22N4OS and a molecular weight of 354.48 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-5-[2-(3-ethylphenoxy)ethylsulfanyl]tetrazole.
| Compound Name | 1-(2,6-dimethylphenyl)-5-[2-(3-ethylphenoxy)ethylsulfanyl]tetrazole |
|---|---|
| PubChem CID | 112771287 |
| Molecular Formula | C19H22N4OS |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-5-[2-(3-ethylphenoxy)ethylsulfanyl]tetrazole |
| SMILES | CCc1cccc(OCCSc2nnnn2-c2c(C)cccc2C)c1 |
| InChI | InChI=1S/C19H22N4OS/c1-4-16-9-6-10-17(13-16)24-11-12-25-19-20-21-22-23(19)18-14(2)7-5-8-15(18)3/h5-10,13H,4,11-12H2,1-3H3 |
| InChIKey | MVTYFQNHYACUFQ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|