C18H18N4O2S — CID 7660949
2-[1-(2,6-dimethylphenyl)tetrazol-5-yl]sulfanylethyl benzoate (PubChem CID 7660949) has the molecular formula C18H18N4O2S and a molecular weight of 354.44 g/mol. Its IUPAC name is 2-[1-(2,6-dimethylphenyl)tetrazol-5-yl]sulfanylethyl benzoate.
| Compound Name | 2-[1-(2,6-dimethylphenyl)tetrazol-5-yl]sulfanylethyl benzoate |
|---|---|
| PubChem CID | 7660949 |
| Molecular Formula | C18H18N4O2S |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 2-[1-(2,6-dimethylphenyl)tetrazol-5-yl]sulfanylethyl benzoate |
| SMILES | Cc1cccc(C)c1-n1nnnc1SCCOC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H18N4O2S/c1-13-7-6-8-14(2)16(13)22-18(19-20-21-22)25-12-11-24-17(23)15-9-4-3-5-10-15/h3-10H,11-12H2,1-2H3 |
| InChIKey | YDIYTRFDQUHPEC-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|