C17H17FN4S2 — CID 7532915
1-(2,6-dimethylphenyl)-5-[2-(2-fluorophenyl)sulfanylethylsulfanyl]tetrazole (PubChem CID 7532915) has the molecular formula C17H17FN4S2 and a molecular weight of 360.48 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-5-[2-(2-fluorophenyl)sulfanylethylsulfanyl]tetrazole.
| Compound Name | 1-(2,6-dimethylphenyl)-5-[2-(2-fluorophenyl)sulfanylethylsulfanyl]tetrazole |
|---|---|
| PubChem CID | 7532915 |
| Molecular Formula | C17H17FN4S2 |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-5-[2-(2-fluorophenyl)sulfanylethylsulfanyl]tetrazole |
| SMILES | Cc1cccc(C)c1-n1nnnc1SCCSc1ccccc1F |
| InChI | InChI=1S/C17H17FN4S2/c1-12-6-5-7-13(2)16(12)22-17(19-20-21-22)24-11-10-23-15-9-4-3-8-14(15)18/h3-9H,10-11H2,1-2H3 |
| InChIKey | WEDCFISULMADGK-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|