C12H16N4OS — CID 110878049
3-[1-(2,6-dimethylphenyl)tetrazol-5-yl]sulfanylpropan-1-ol (PubChem CID 110878049) has the molecular formula C12H16N4OS and a molecular weight of 264.35 g/mol. Its IUPAC name is 3-[1-(2,6-dimethylphenyl)tetrazol-5-yl]sulfanylpropan-1-ol.
| Compound Name | 3-[1-(2,6-dimethylphenyl)tetrazol-5-yl]sulfanylpropan-1-ol |
|---|---|
| PubChem CID | 110878049 |
| Molecular Formula | C12H16N4OS |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 3-[1-(2,6-dimethylphenyl)tetrazol-5-yl]sulfanylpropan-1-ol |
| SMILES | Cc1cccc(C)c1-n1nnnc1SCCCO |
| InChI | InChI=1S/C12H16N4OS/c1-9-5-3-6-10(2)11(9)16-12(13-14-15-16)18-8-4-7-17/h3,5-6,17H,4,7-8H2,1-2H3 |
| InChIKey | GUNPDSFQHRGEMM-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|