C23H19N5OS — CID 60516534
3-[2-[[4-(2-methylphenyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]ethoxy]benzonitrile (PubChem CID 60516534) has the molecular formula C23H19N5OS and a molecular weight of 413.51 g/mol. Its IUPAC name is 3-[2-[[4-(2-methylphenyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]ethoxy]benzonitrile.
| Compound Name | 3-[2-[[4-(2-methylphenyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]ethoxy]benzonitrile |
|---|---|
| PubChem CID | 60516534 |
| Molecular Formula | C23H19N5OS |
| Molecular Weight | 413.51 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | 3-[2-[[4-(2-methylphenyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]ethoxy]benzonitrile |
| SMILES | Cc1ccccc1-n1c(SCCOc2cccc(C#N)c2)nnc1-c1cccnc1 |
| InChI | InChI=1S/C23H19N5OS/c1-17-6-2-3-10-21(17)28-22(19-8-5-11-25-16-19)26-27-23(28)30-13-12-29-20-9-4-7-18(14-20)15-24/h2-11,14,16H,12-13H2,1H3 |
| InChIKey | MPGAFYSAIWBZEU-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 76.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.51 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|