C23H25N5O2S — CID 60517773
3-[2-[[4-(2-methoxyphenyl)-5-piperidin-1-yl-1,2,4-triazol-3-yl]sulfanyl]ethoxy]benzonitrile (PubChem CID 60517773) has the molecular formula C23H25N5O2S and a molecular weight of 435.55 g/mol. Its IUPAC name is 3-[2-[[4-(2-methoxyphenyl)-5-piperidin-1-yl-1,2,4-triazol-3-yl]sulfanyl]ethoxy]benzonitrile.
| Compound Name | 3-[2-[[4-(2-methoxyphenyl)-5-piperidin-1-yl-1,2,4-triazol-3-yl]sulfanyl]ethoxy]benzonitrile |
|---|---|
| PubChem CID | 60517773 |
| Molecular Formula | C23H25N5O2S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 3-[2-[[4-(2-methoxyphenyl)-5-piperidin-1-yl-1,2,4-triazol-3-yl]sulfanyl]ethoxy]benzonitrile |
| SMILES | COc1ccccc1-n1c(SCCOc2cccc(C#N)c2)nnc1N1CCCCC1 |
| InChI | InChI=1S/C23H25N5O2S/c1-29-21-11-4-3-10-20(21)28-22(27-12-5-2-6-13-27)25-26-23(28)31-15-14-30-19-9-7-8-18(16-19)17-24/h3-4,7-11,16H,2,5-6,12-15H2,1H3 |
| InChIKey | SBNYPHNOGRXPHW-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 76.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|