About 3-(2-imidazo[1,5-a]pyridin-3-ylsulfanylethoxy)benzonitrile
3-(2-imidazo[1,5-a]pyridin-3-ylsulfanylethoxy)benzonitrile (PubChem CID 60515102) has the molecular formula C16H13N3OS
and a molecular weight of 295.37 g/mol. Its IUPAC name is 3-(2-imidazo[1,5-a]pyridin-3-ylsulfanylethoxy)benzonitrile.
Molecular Properties
| Compound Name | 3-(2-imidazo[1,5-a]pyridin-3-ylsulfanylethoxy)benzonitrile |
| PubChem CID | 60515102 |
| Molecular Formula | C16H13N3OS |
| Molecular Weight | 295.37 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 3-(2-imidazo[1,5-a]pyridin-3-ylsulfanylethoxy)benzonitrile |
| SMILES | N#Cc1cccc(OCCSc2ncc3ccccn23)c1 |
| InChI | InChI=1S/C16H13N3OS/c17-11-13-4-3-6-15(10-13)20-8-9-21-16-18-12-14-5-1-2-7-19(14)16/h1-7,10,12H,8-9H2 |
| InChIKey | HKVSHHGGZBENDU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 50.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.37 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-imidazo[1,5-a]pyridin-3-ylsulfanylethoxy)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-imidazo[1,5-a]pyridin-3-ylsulfanylethoxy)benzonitrile?
The IUPAC name of 3-(2-imidazo[1,5-a]pyridin-3-ylsulfanylethoxy)benzonitrile (CID 60515102) is 3-(2-imidazo[1,5-a]pyridin-3-ylsulfanylethoxy)benzonitrile.
What is the SMILES notation for 3-(2-imidazo[1,5-a]pyridin-3-ylsulfanylethoxy)benzonitrile?
The canonical SMILES for 3-(2-imidazo[1,5-a]pyridin-3-ylsulfanylethoxy)benzonitrile is N#Cc1cccc(OCCSc2ncc3ccccn23)c1.
What is the InChIKey of 3-(2-imidazo[1,5-a]pyridin-3-ylsulfanylethoxy)benzonitrile?
The InChIKey is HKVSHHGGZBENDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13N3OS/c17-11-13-4-3-6-15(10-13)20-8-9-21-16-18-12-14-5-1-2-7-19(14)16/h1-7,10,12H,8-9H2.
What are the key properties of 3-(2-imidazo[1,5-a]pyridin-3-ylsulfanylethoxy)benzonitrile?
3-(2-imidazo[1,5-a]pyridin-3-ylsulfanylethoxy)benzonitrile has a molecular weight of 295.37 g/mol, XLogP of 3.38, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-imidazo[1,5-a]pyridin-3-ylsulfanylethoxy)benzonitrile is sourced from PubChem (CID 60515102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).