C16H13N3OS — CID 60515102
3-(2-imidazo[1,5-a]pyridin-3-ylsulfanylethoxy)benzonitrile (PubChem CID 60515102) has the molecular formula C16H13N3OS and a molecular weight of 295.37 g/mol. Its IUPAC name is 3-(2-imidazo[1,5-a]pyridin-3-ylsulfanylethoxy)benzonitrile.
| Compound Name | 3-(2-imidazo[1,5-a]pyridin-3-ylsulfanylethoxy)benzonitrile |
|---|---|
| PubChem CID | 60515102 |
| Molecular Formula | C16H13N3OS |
| Molecular Weight | 295.37 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 3-(2-imidazo[1,5-a]pyridin-3-ylsulfanylethoxy)benzonitrile |
| SMILES | N#Cc1cccc(OCCSc2ncc3ccccn23)c1 |
| InChI | InChI=1S/C16H13N3OS/c17-11-13-4-3-6-15(10-13)20-8-9-21-16-18-12-14-5-1-2-7-19(14)16/h1-7,10,12H,8-9H2 |
| InChIKey | HKVSHHGGZBENDU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 50.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.37 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|