C23H18N4O2S — CID 60514861
3-[2-[3-(5-methyl-2-pyridinyl)-4-oxoquinazolin-2-yl]sulfanylethoxy]benzonitrile (PubChem CID 60514861) has the molecular formula C23H18N4O2S and a molecular weight of 414.49 g/mol. Its IUPAC name is 3-[2-[3-(5-methyl-2-pyridinyl)-4-oxoquinazolin-2-yl]sulfanylethoxy]benzonitrile.
| Compound Name | 3-[2-[3-(5-methyl-2-pyridinyl)-4-oxoquinazolin-2-yl]sulfanylethoxy]benzonitrile |
|---|---|
| PubChem CID | 60514861 |
| Molecular Formula | C23H18N4O2S |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 3-[2-[3-(5-methyl-2-pyridinyl)-4-oxoquinazolin-2-yl]sulfanylethoxy]benzonitrile |
| SMILES | Cc1ccc(-n2c(SCCOc3cccc(C#N)c3)nc3ccccc3c2=O)nc1 |
| InChI | InChI=1S/C23H18N4O2S/c1-16-9-10-21(25-15-16)27-22(28)19-7-2-3-8-20(19)26-23(27)30-12-11-29-18-6-4-5-17(13-18)14-24/h2-10,13,15H,11-12H2,1H3 |
| InChIKey | DDVWVSDVYQBWIH-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 80.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|