C16H15N3O2S — CID 42895290
2-(2-hydroxyethylsulfanyl)-3-(5-methyl-2-pyridinyl)quinazolin-4-one (PubChem CID 42895290) has the molecular formula C16H15N3O2S and a molecular weight of 313.38 g/mol. Its IUPAC name is 2-(2-hydroxyethylsulfanyl)-3-(5-methyl-2-pyridinyl)quinazolin-4-one.
| Compound Name | 2-(2-hydroxyethylsulfanyl)-3-(5-methyl-2-pyridinyl)quinazolin-4-one |
|---|---|
| PubChem CID | 42895290 |
| Molecular Formula | C16H15N3O2S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 2-(2-hydroxyethylsulfanyl)-3-(5-methyl-2-pyridinyl)quinazolin-4-one |
| SMILES | Cc1ccc(-n2c(SCCO)nc3ccccc3c2=O)nc1 |
| InChI | InChI=1S/C16H15N3O2S/c1-11-6-7-14(17-10-11)19-15(21)12-4-2-3-5-13(12)18-16(19)22-9-8-20/h2-7,10,20H,8-9H2,1H3 |
| InChIKey | PSTUBTSRKGSAAZ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |