C22H18ClN3O2S — CID 42984421
2-[2-(3-chlorophenoxy)ethylsulfanyl]-3-(5-methyl-2-pyridinyl)quinazolin-4-one (PubChem CID 42984421) has the molecular formula C22H18ClN3O2S and a molecular weight of 423.93 g/mol. Its IUPAC name is 2-[2-(3-chlorophenoxy)ethylsulfanyl]-3-(5-methyl-2-pyridinyl)quinazolin-4-one.
| Compound Name | 2-[2-(3-chlorophenoxy)ethylsulfanyl]-3-(5-methyl-2-pyridinyl)quinazolin-4-one |
|---|---|
| PubChem CID | 42984421 |
| Molecular Formula | C22H18ClN3O2S |
| Molecular Weight | 423.93 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | 2-[2-(3-chlorophenoxy)ethylsulfanyl]-3-(5-methyl-2-pyridinyl)quinazolin-4-one |
| SMILES | Cc1ccc(-n2c(SCCOc3cccc(Cl)c3)nc3ccccc3c2=O)nc1 |
| InChI | InChI=1S/C22H18ClN3O2S/c1-15-9-10-20(24-14-15)26-21(27)18-7-2-3-8-19(18)25-22(26)29-12-11-28-17-6-4-5-16(23)13-17/h2-10,13-14H,11-12H2,1H3 |
| InChIKey | KWFWVNPFPJDLPI-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.93 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|