C13H14N4OS2 — CID 47288425
3-[2-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethoxy]benzonitrile (PubChem CID 47288425) has the molecular formula C13H14N4OS2 and a molecular weight of 306.42 g/mol. Its IUPAC name is 3-[2-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethoxy]benzonitrile.
| Compound Name | 3-[2-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethoxy]benzonitrile |
|---|---|
| PubChem CID | 47288425 |
| Molecular Formula | C13H14N4OS2 |
| Molecular Weight | 306.42 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 3-[2-[[5-(ethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethoxy]benzonitrile |
| SMILES | CCNc1nnc(SCCOc2cccc(C#N)c2)s1 |
| InChI | InChI=1S/C13H14N4OS2/c1-2-15-12-16-17-13(20-12)19-7-6-18-11-5-3-4-10(8-11)9-14/h3-5,8H,2,6-7H2,1H3,(H,15,16) |
| InChIKey | UKHNHUCQPWWZMV-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.42 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|